C19H15F3N2O7S — CID 86716924
N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 86716924) has the molecular formula C19H15F3N2O7S and a molecular weight of 472.40 g/mol. Its IUPAC name is N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 86716924 |
| Molecular Formula | C19H15F3N2O7S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc([N+](=O)[O-])c3C(=O)C21NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H15F3N2O7S/c1-9(2)10-6-7-11-14(8-10)31-18(26)12-4-3-5-13(24(27)28)15(12)16(25)17(11,18)23-32(29,30)19(20,21)22/h3-9,23,26H,1-2H3 |
| InChIKey | CXERYZYPTMHROV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|