C23H27N3O5 — CID 8671719
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 8671719) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 8671719 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)CCCN3C(=O)NC4(CCCC4)C3=O)c[nH]c12 |
| InChI | InChI=1S/C23H27N3O5/c1-2-15-7-5-8-16-17(13-24-20(15)16)18(27)14-31-19(28)9-6-12-26-21(29)23(25-22(26)30)10-3-4-11-23/h5,7-8,13,24H,2-4,6,9-12,14H2,1H3,(H,25,30) |
| InChIKey | AMQDRLXSJGCRGN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|