About 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine
4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine (PubChem CID 86717364) has the molecular formula C17H9ClF2N4
and a molecular weight of 342.74 g/mol. Its IUPAC name is 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine |
| PubChem CID | 86717364 |
| Molecular Formula | C17H9ClF2N4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine |
| SMILES | Fc1ccc(-c2n[nH]c3nnc(-c4ccccc4)c(Cl)c23)cc1F |
| InChI | InChI=1S/C17H9ClF2N4/c18-14-13-15(10-6-7-11(19)12(20)8-10)21-23-17(13)24-22-16(14)9-4-2-1-3-5-9/h1-8H,(H,21,23,24) |
| InChIKey | VBPYGLAZFSHEJE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine?
The IUPAC name of 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine (CID 86717364) is 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine.
What is the SMILES notation for 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine?
The canonical SMILES for 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine is Fc1ccc(-c2n[nH]c3nnc(-c4ccccc4)c(Cl)c23)cc1F.
What is the InChIKey of 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine?
The InChIKey is VBPYGLAZFSHEJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF2N4/c18-14-13-15(10-6-7-11(19)12(20)8-10)21-23-17(13)24-22-16(14)9-4-2-1-3-5-9/h1-8H,(H,21,23,24).
What are the key properties of 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine?
4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine has a molecular weight of 342.74 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(3,4-difluorophenyl)-5-phenyl-1H-pyrazolo[3,4-c]pyridazine is sourced from PubChem (CID 86717364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).