C17H27BClNO2 — CID 86717372
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride (PubChem CID 86717372) has the molecular formula C17H27BClNO2 and a molecular weight of 323.67 g/mol. Its IUPAC name is 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride.
| Compound Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 86717372 |
| Molecular Formula | C17H27BClNO2 |
| Molecular Weight | 323.67 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride |
| SMILES | CC1(C)OB(c2ccc(C3CCNCC3)cc2)OC1(C)C.Cl |
| InChI | InChI=1S/C17H26BNO2.ClH/c1-16(2)17(3,4)21-18(20-16)15-7-5-13(6-8-15)14-9-11-19-12-10-14;/h5-8,14,19H,9-12H2,1-4H3;1H |
| InChIKey | ZDTFTNOEDGNRNF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|