About tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate
tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 86717373) has the molecular formula C18H23ClFN5O2
and a molecular weight of 395.87 g/mol. Its IUPAC name is tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
| PubChem CID | 86717373 |
| Molecular Formula | C18H23ClFN5O2 |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(CNc2nc(Cl)cc3nccnc23)C1 |
| InChI | InChI=1S/C18H23ClFN5O2/c1-17(2,3)27-16(26)25-8-4-5-18(20,11-25)10-23-15-14-12(9-13(19)24-15)21-6-7-22-14/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,23,24) |
| InChIKey | LEFKXGWTOZZLSF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate (CID 86717373) is tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(F)(CNc2nc(Cl)cc3nccnc23)C1.
What is the InChIKey of tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate?
The InChIKey is LEFKXGWTOZZLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClFN5O2/c1-17(2,3)27-16(26)25-8-4-5-18(20,11-25)10-23-15-14-12(9-13(19)24-15)21-6-7-22-14/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,23,24).
What are the key properties of tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate?
tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate has a molecular weight of 395.87 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 86717373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).