About [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate
[4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate (PubChem CID 86717415) has the molecular formula C15H19N3O5S2
and a molecular weight of 385.47 g/mol. Its IUPAC name is [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate |
| PubChem CID | 86717415 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CCC(Nc2c([N+](=O)[O-])cnc3ccsc23)CC1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-25(21,22)23-9-10-2-4-11(5-3-10)17-14-13(18(19)20)8-16-12-6-7-24-15(12)14/h6-8,10-11H,2-5,9H2,1H3,(H,16,17) |
| InChIKey | DQGHYPRWTJXVAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate?
The IUPAC name of [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate (CID 86717415) is [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate.
What is the SMILES notation for [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate?
The canonical SMILES for [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate is CS(=O)(=O)OCC1CCC(Nc2c([N+](=O)[O-])cnc3ccsc23)CC1.
What is the InChIKey of [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate?
The InChIKey is DQGHYPRWTJXVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O5S2/c1-25(21,22)23-9-10-2-4-11(5-3-10)17-14-13(18(19)20)8-16-12-6-7-24-15(12)14/h6-8,10-11H,2-5,9H2,1H3,(H,16,17).
What are the key properties of [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate?
[4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate has a molecular weight of 385.47 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(6-nitrothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]methyl methanesulfonate is sourced from PubChem (CID 86717415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).