About 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile
3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile (PubChem CID 86717433) has the molecular formula C16H20N4S
and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile |
| PubChem CID | 86717433 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile |
| SMILES | N#CCCC1CCC(Nc2c(N)cnc3ccsc23)CC1 |
| InChI | InChI=1S/C16H20N4S/c17-8-1-2-11-3-5-12(6-4-11)20-15-13(18)10-19-14-7-9-21-16(14)15/h7,9-12H,1-6,18H2,(H,19,20) |
| InChIKey | ISYUELQWJPOPSO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile?
The IUPAC name of 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile (CID 86717433) is 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile.
What is the SMILES notation for 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile?
The canonical SMILES for 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile is N#CCCC1CCC(Nc2c(N)cnc3ccsc23)CC1.
What is the InChIKey of 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile?
The InChIKey is ISYUELQWJPOPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4S/c17-8-1-2-11-3-5-12(6-4-11)20-15-13(18)10-19-14-7-9-21-16(14)15/h7,9-12H,1-6,18H2,(H,19,20).
What are the key properties of 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile?
3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile has a molecular weight of 300.43 g/mol, XLogP of 4.15, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]cyclohexyl]propanenitrile is sourced from PubChem (CID 86717433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).