About 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride
8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride (PubChem CID 86717886) has the molecular formula C16H11ClF2N2O2
and a molecular weight of 336.73 g/mol. Its IUPAC name is 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride.
Molecular Properties
| Compound Name | 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride |
| PubChem CID | 86717886 |
| Molecular Formula | C16H11ClF2N2O2 |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride |
| SMILES | Cc1nc2c(OCc3c(F)cccc3F)cccn2c1C(=O)Cl |
| InChI | InChI=1S/C16H11ClF2N2O2/c1-9-14(15(17)22)21-7-3-6-13(16(21)20-9)23-8-10-11(18)4-2-5-12(10)19/h2-7H,8H2,1H3 |
| InChIKey | GMSOYKAXMZJAIM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride?
The IUPAC name of 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride (CID 86717886) is 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride.
What is the SMILES notation for 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride?
The canonical SMILES for 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride is Cc1nc2c(OCc3c(F)cccc3F)cccn2c1C(=O)Cl.
What is the InChIKey of 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride?
The InChIKey is GMSOYKAXMZJAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF2N2O2/c1-9-14(15(17)22)21-7-3-6-13(16(21)20-9)23-8-10-11(18)4-2-5-12(10)19/h2-7H,8H2,1H3.
What are the key properties of 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride?
8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride has a molecular weight of 336.73 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl chloride is sourced from PubChem (CID 86717886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).