C28H32ClF5N4O6 — CID 86717905
tert-butyl N-[4-[[6-chloro-8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 86717905) has the molecular formula C28H32ClF5N4O6 and a molecular weight of 651.03 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-chloro-8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl N-[4-[[6-chloro-8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86717905 |
| Molecular Formula | C28H32ClF5N4O6 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | tert-butyl N-[4-[[6-chloro-8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc2c(OCc3c(F)cccc3F)cc(Cl)cn2c1C(=O)NCCC(C)(C)NC(=O)OC(C)(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H31ClF2N4O4.C2HF3O2/c1-15-21(23(34)30-11-10-26(5,6)32-24(35)37-25(2,3)4)33-13-16(27)12-20(22(33)31-15)36-14-17-18(28)8-7-9-19(17)29;3-2(4,5)1(6)7/h7-9,12-13H,10-11,14H2,1-6H3,(H,30,34)(H,32,35);(H,6,7) |
| InChIKey | ZXBPXVYKZKYRHC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |