C29H33F5N4O6 — CID 86717914
tert-butyl (2R)-2-[[[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carbonyl]amino]methyl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 86717914) has the molecular formula C29H33F5N4O6 and a molecular weight of 628.60 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carbonyl]amino]methyl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl (2R)-2-[[[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carbonyl]amino]methyl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86717914 |
| Molecular Formula | C29H33F5N4O6 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | tert-butyl (2R)-2-[[[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carbonyl]amino]methyl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(OCc2c(F)cccc2F)c2nc(C)c(C(=O)NC[C@H]3CCCN3C(=O)OC(C)(C)C)n2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H32F2N4O4.C2HF3O2/c1-16-12-22(36-15-19-20(28)9-6-10-21(19)29)24-31-17(2)23(33(24)14-16)25(34)30-13-18-8-7-11-32(18)26(35)37-27(3,4)5;3-2(4,5)1(6)7/h6,9-10,12,14,18H,7-8,11,13,15H2,1-5H3,(H,30,34);(H,6,7)/t18-;/m1./s1 |
| InChIKey | YOCAKWYWLMZDQE-GMUIIQOCSA-N |
| XLogP | 5.57 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |