C29H38N6O2S — CID 86718080
N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 86718080) has the molecular formula C29H38N6O2S and a molecular weight of 534.73 g/mol. Its IUPAC name is N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86718080 |
| Molecular Formula | C29H38N6O2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | COc1cccc([C@H](C)NC(=O)N2CCN(c3ncnc4cc(C5=CC(C)(C)NC(C)(C)C5)sc34)CC2)c1 |
| InChI | InChI=1S/C29H38N6O2S/c1-19(20-8-7-9-22(14-20)37-6)32-27(36)35-12-10-34(11-13-35)26-25-23(30-18-31-26)15-24(38-25)21-16-28(2,3)33-29(4,5)17-21/h7-9,14-16,18-19,33H,10-13,17H2,1-6H3,(H,32,36)/t19-/m0/s1 |
| InChIKey | UYCQNRKFUMWWBD-IBGZPJMESA-N |
| XLogP | 5.23 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |