C26H31ClN6OS — CID 86718087
N-[(1S)-1-(3-chlorophenyl)ethyl]-2,2-dimethyl-4-[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 86718087) has the molecular formula C26H31ClN6OS and a molecular weight of 511.10 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2,2-dimethyl-4-[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2,2-dimethyl-4-[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86718087 |
| Molecular Formula | C26H31ClN6OS |
| Molecular Weight | 511.10 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2,2-dimethyl-4-[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCN(c2ncnc3cc(C4=CCNCC4)sc23)CC1(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H31ClN6OS/c1-17(19-5-4-6-20(27)13-19)31-25(34)33-12-11-32(15-26(33,2)3)24-23-21(29-16-30-24)14-22(35-23)18-7-9-28-10-8-18/h4-7,13-14,16-17,28H,8-12,15H2,1-3H3,(H,31,34)/t17-/m0/s1 |
| InChIKey | DTGCMLPHSJDEHK-KRWDZBQOSA-N |
| XLogP | 5.09 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.10 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |