C16H13F9N4O4S — CID 86718390
1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(methoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea (PubChem CID 86718390) has the molecular formula C16H13F9N4O4S and a molecular weight of 528.35 g/mol. Its IUPAC name is 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(methoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea.
| Compound Name | 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(methoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea |
|---|---|
| PubChem CID | 86718390 |
| Molecular Formula | C16H13F9N4O4S |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(methoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea |
| SMILES | COCN(C(=O)Nc1ccc(C(F)(F)F)s1)c1nc(OCC(F)(F)F)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H13F9N4O4S/c1-31-7-29(13(30)28-11-3-2-8(34-11)16(23,24)25)12-26-9(32-5-14(17,18)19)4-10(27-12)33-6-15(20,21)22/h2-4H,5-7H2,1H3,(H,28,30) |
| InChIKey | MTKNBRVQWFDAPT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|