C22H17F9N4O4S — CID 86718393
1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(phenylmethoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea (PubChem CID 86718393) has the molecular formula C22H17F9N4O4S and a molecular weight of 604.45 g/mol. Its IUPAC name is 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(phenylmethoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea.
| Compound Name | 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(phenylmethoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea |
|---|---|
| PubChem CID | 86718393 |
| Molecular Formula | C22H17F9N4O4S |
| Molecular Weight | 604.45 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | 1-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-(phenylmethoxymethyl)-3-[5-(trifluoromethyl)thiophen-2-yl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)s1)N(COCc1ccccc1)c1nc(OCC(F)(F)F)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C22H17F9N4O4S/c23-20(24,25)10-38-15-8-16(39-11-21(26,27)28)33-18(32-15)35(12-37-9-13-4-2-1-3-5-13)19(36)34-17-7-6-14(40-17)22(29,30)31/h1-8H,9-12H2,(H,34,36) |
| InChIKey | ZOMUOZJSIWCRNA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|