C27H41NO7 — CID 86718412
methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-hydroxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate (PubChem CID 86718412) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-hydroxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate.
| Compound Name | methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-hydroxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
|---|---|
| PubChem CID | 86718412 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-hydroxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@]2(CO2)C[C@@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)O)C[C@@H]2C)O1 |
| InChI | InChI=1S/C27H41NO7/c1-17(6-9-21-14-27(16-33-27)15-22(35-21)13-26(31)32-5)7-10-24-18(2)12-23(20(4)34-24)28-25(30)11-8-19(3)29/h6-9,11,18-24,29H,10,12-16H2,1-5H3,(H,28,30)/b9-6+,11-8-,17-7+/t18-,19-,20+,21+,22+,23+,24-,27+/m0/s1 |
| InChIKey | OZFWBSWZGKELPZ-GKUJJCFVSA-N |
| XLogP | 2.99 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|