C29H43NO8 — CID 86718413
methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate (PubChem CID 86718413) has the molecular formula C29H43NO8 and a molecular weight of 533.66 g/mol. Its IUPAC name is methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate.
| Compound Name | methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
|---|---|
| PubChem CID | 86718413 |
| Molecular Formula | C29H43NO8 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | methyl 2-[(3S,5S,7S)-5-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@]2(CO2)C[C@@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)OC(C)=O)C[C@@H]2C)O1 |
| InChI | InChI=1S/C29H43NO8/c1-18(7-10-23-15-29(17-35-29)16-24(38-23)14-28(33)34-6)8-11-26-19(2)13-25(21(4)37-26)30-27(32)12-9-20(3)36-22(5)31/h7-10,12,19-21,23-26H,11,13-17H2,1-6H3,(H,30,32)/b10-7+,12-9-,18-8+/t19-,20-,21+,23+,24+,25+,26-,29+/m0/s1 |
| InChIKey | ONBCOTUPAXAPJD-XMUQUJJGSA-N |
| XLogP | 3.56 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|