C26H41N3O5 — CID 86718416
(E)-4-amino-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3S,5S,7S)-7-(2-amino-2-oxoethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide (PubChem CID 86718416) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is (E)-4-amino-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3S,5S,7S)-7-(2-amino-2-oxoethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide.
| Compound Name | (E)-4-amino-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3S,5S,7S)-7-(2-amino-2-oxoethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 86718416 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | (E)-4-amino-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3S,5S,7S)-7-(2-amino-2-oxoethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
| SMILES | CC(/C=C/[C@@H]1C[C@]2(CO2)C[C@@H](CC(N)=O)O1)=C\C[C@@H]1O[C@H](C)[C@H](NC(=O)/C=C/C(C)N)C[C@@H]1C |
| InChI | InChI=1S/C26H41N3O5/c1-16(5-8-20-13-26(15-32-26)14-21(34-20)12-24(28)30)6-9-23-17(2)11-22(19(4)33-23)29-25(31)10-7-18(3)27/h5-8,10,17-23H,9,11-15,27H2,1-4H3,(H2,28,30)(H,29,31)/b8-5+,10-7+,16-6+/t17-,18?,19+,20+,21+,22+,23-,26+/m0/s1 |
| InChIKey | VAIULLVGPDRLHQ-LHDJMJSHSA-N |
| XLogP | 2.27 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|