C24H40O4 — CID 86718446
(2S,3S)-3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-(4-methoxy-4-methylpentyl)-2-methyloxirane (PubChem CID 86718446) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (2S,3S)-3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-(4-methoxy-4-methylpentyl)-2-methyloxirane.
| Compound Name | (2S,3S)-3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-(4-methoxy-4-methylpentyl)-2-methyloxirane |
|---|---|
| PubChem CID | 86718446 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (2S,3S)-3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-(4-methoxy-4-methylpentyl)-2-methyloxirane |
| SMILES | COC1=CCC=C(OC)C1(CC=C(C)C)C[C@@H]1O[C@@]1(C)CCCC(C)(C)OC |
| InChI | InChI=1S/C24H40O4/c1-18(2)13-16-24(19(25-6)11-9-12-20(24)26-7)17-21-23(5,28-21)15-10-14-22(3,4)27-8/h11-13,21H,9-10,14-17H2,1-8H3/t21-,23-/m0/s1 |
| InChIKey | XKOROOMPDKMFIL-GMAHTHKFSA-N |
| XLogP | 5.94 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|