C13H14FNO6 — CID 86718462
(3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-6-methyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol (PubChem CID 86718462) has the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. Its IUPAC name is (3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-6-methyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol.
| Compound Name | (3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-6-methyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 86718462 |
| Molecular Formula | C13H14FNO6 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-6-methyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol |
| SMILES | C[C@@]1(O)CO[C@@H]2[C@H](Oc3cc(F)ccc3[N+](=O)[O-])CO[C@@H]21 |
| InChI | InChI=1S/C13H14FNO6/c1-13(16)6-20-11-10(5-19-12(11)13)21-9-4-7(14)2-3-8(9)15(17)18/h2-4,10-12,16H,5-6H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | LNUKQAOADDWBID-FVCCEPFGSA-N |
| XLogP | 1.03 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|