C18H20N6 — CID 86718708
4,9-bis(ethenyl)-5,10-dimethylpyrido[3,4-g]isoquinoline-1,3,6,8-tetramine (PubChem CID 86718708) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4,9-bis(ethenyl)-5,10-dimethylpyrido[3,4-g]isoquinoline-1,3,6,8-tetramine.
| Compound Name | 4,9-bis(ethenyl)-5,10-dimethylpyrido[3,4-g]isoquinoline-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 86718708 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4,9-bis(ethenyl)-5,10-dimethylpyrido[3,4-g]isoquinoline-1,3,6,8-tetramine |
| SMILES | C=Cc1c(N)nc(N)c2c(C)c3c(C=C)c(N)nc(N)c3c(C)c12 |
| InChI | InChI=1S/C18H20N6/c1-5-9-11-7(3)14-12(10(6-2)16(20)24-18(14)22)8(4)13(11)17(21)23-15(9)19/h5-6H,1-2H2,3-4H3,(H4,19,21,23)(H4,20,22,24) |
| InChIKey | GPNYZTFDKZBQCK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|