About 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol
2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol (PubChem CID 86718751) has the molecular formula C25H26Cl3NO
and a molecular weight of 462.85 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol.
Molecular Properties
| Compound Name | 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol |
| PubChem CID | 86718751 |
| Molecular Formula | C25H26Cl3NO |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol |
| SMILES | CC(C)(C)NCc1cc(CCc2ccc(Cl)cc2)cc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C25H26Cl3NO/c1-25(2,3)29-15-19-12-17(5-4-16-6-9-20(26)10-7-16)13-21(24(19)30)18-8-11-22(27)23(28)14-18/h6-14,29-30H,4-5,15H2,1-3H3 |
| InChIKey | FMBAVYXNFOKXIN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol?
The IUPAC name of 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol (CID 86718751) is 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol.
What is the SMILES notation for 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol?
The canonical SMILES for 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol is CC(C)(C)NCc1cc(CCc2ccc(Cl)cc2)cc(-c2ccc(Cl)c(Cl)c2)c1O.
What is the InChIKey of 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol?
The InChIKey is FMBAVYXNFOKXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26Cl3NO/c1-25(2,3)29-15-19-12-17(5-4-16-6-9-20(26)10-7-16)13-21(24(19)30)18-8-11-22(27)23(28)14-18/h6-14,29-30H,4-5,15H2,1-3H3.
What are the key properties of 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol?
2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol has a molecular weight of 462.85 g/mol, XLogP of 7.69, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(tert-butylamino)methyl]-4-[2-(4-chlorophenyl)ethyl]-6-(3,4-dichlorophenyl)phenol is sourced from PubChem (CID 86718751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).