About 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine
5-methyl-N,N-dipropyl-1H-pyrazol-3-amine (PubChem CID 86718912) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine |
| PubChem CID | 86718912 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine |
| SMILES | CCCN(CCC)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C10H19N3/c1-4-6-13(7-5-2)10-8-9(3)11-12-10/h8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | BULQPTAYJWCALP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine?
The IUPAC name of 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine (CID 86718912) is 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine.
What is the SMILES notation for 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine?
The canonical SMILES for 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine is CCCN(CCC)c1cc(C)[nH]n1.
What is the InChIKey of 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine?
The InChIKey is BULQPTAYJWCALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-4-6-13(7-5-2)10-8-9(3)11-12-10/h8H,4-7H2,1-3H3,(H,11,12).
What are the key properties of 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine?
5-methyl-N,N-dipropyl-1H-pyrazol-3-amine has a molecular weight of 181.28 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,N-dipropyl-1H-pyrazol-3-amine is sourced from PubChem (CID 86718912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).