C23H27N3O3 — CID 86718981
3-[2,3-dimethyl-1-(phenylmethoxymethyl)-1,4-dihydropyridazino[4,5-b]indol-5-yl]propanoic acid (PubChem CID 86718981) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[2,3-dimethyl-1-(phenylmethoxymethyl)-1,4-dihydropyridazino[4,5-b]indol-5-yl]propanoic acid.
| Compound Name | 3-[2,3-dimethyl-1-(phenylmethoxymethyl)-1,4-dihydropyridazino[4,5-b]indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 86718981 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[2,3-dimethyl-1-(phenylmethoxymethyl)-1,4-dihydropyridazino[4,5-b]indol-5-yl]propanoic acid |
| SMILES | CN1Cc2c(c3ccccc3n2CCC(=O)O)C(COCc2ccccc2)N1C |
| InChI | InChI=1S/C23H27N3O3/c1-24-14-20-23(18-10-6-7-11-19(18)26(20)13-12-22(27)28)21(25(24)2)16-29-15-17-8-4-3-5-9-17/h3-11,21H,12-16H2,1-2H3,(H,27,28) |
| InChIKey | WCSPSHTZGRJACG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|