About ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate
ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate (PubChem CID 86719750) has the molecular formula C14H19ClFN3O3
and a molecular weight of 331.78 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate |
| PubChem CID | 86719750 |
| Molecular Formula | C14H19ClFN3O3 |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C14H19ClFN3O3/c1-2-22-11(20)7-14(21)5-3-4-9(6-14)18-12-10(16)8-17-13(15)19-12/h8-9,21H,2-7H2,1H3,(H,17,18,19)/t9-,14+/m0/s1 |
| InChIKey | IQBDXSNXWWFCRV-LKFCYVNXSA-N |
| XLogP | 2.31 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate?
The IUPAC name of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate (CID 86719750) is ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate?
The canonical SMILES for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate is CCOC(=O)C[C@@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate?
The InChIKey is IQBDXSNXWWFCRV-LKFCYVNXSA-N. The full InChI is InChI=1S/C14H19ClFN3O3/c1-2-22-11(20)7-14(21)5-3-4-9(6-14)18-12-10(16)8-17-13(15)19-12/h8-9,21H,2-7H2,1H3,(H,17,18,19)/t9-,14+/m0/s1.
What are the key properties of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate?
ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate has a molecular weight of 331.78 g/mol, XLogP of 2.31, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate is sourced from PubChem (CID 86719750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).