About ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate
ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate (PubChem CID 86719812) has the molecular formula C14H17F3N2O2
and a molecular weight of 302.30 g/mol. Its IUPAC name is ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate |
| PubChem CID | 86719812 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(F)(F)F)c2c1CCCC21CC1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-2-21-10(20)8-19-9-4-3-5-13(6-7-13)11(9)12(18-19)14(15,16)17/h2-8H2,1H3 |
| InChIKey | GYJWYYQPUTWLHP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate?
The IUPAC name of ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate (CID 86719812) is ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate?
The canonical SMILES for ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate is CCOC(=O)Cn1nc(C(F)(F)F)c2c1CCCC21CC1.
What is the InChIKey of ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate?
The InChIKey is GYJWYYQPUTWLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2O2/c1-2-21-10(20)8-19-9-4-3-5-13(6-7-13)11(9)12(18-19)14(15,16)17/h2-8H2,1H3.
What are the key properties of ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate?
ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate has a molecular weight of 302.30 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]acetate is sourced from PubChem (CID 86719812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).