C32H30BF6N5O4 — CID 86719874
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 86719874) has the molecular formula C32H30BF6N5O4 and a molecular weight of 673.42 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 86719874 |
| Molecular Formula | C32H30BF6N5O4 |
| Molecular Weight | 673.42 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | CC1(C)OB(c2cn(CC(=O)N[C@@H](Cc3cc(F)cc(F)c3)c3ncccc3-c3ccc(F)c(C(N)=O)c3)nc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C32H30BF6N5O4/c1-30(2)31(3,4)48-33(47-30)23-15-44(43-28(23)32(37,38)39)16-26(45)42-25(12-17-10-19(34)14-20(35)11-17)27-21(6-5-9-41-27)18-7-8-24(36)22(13-18)29(40)46/h5-11,13-15,25H,12,16H2,1-4H3,(H2,40,46)(H,42,45)/t25-/m0/s1 |
| InChIKey | ANKMHAWLQJVIRK-VWLOTQADSA-N |
| XLogP | 4.88 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|