C30H23F6N7O3 — CID 86720058
9-[(2,4-dimethoxyphenyl)methyl]-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-(2,2,3,3,3-pentafluoropropyl)purin-8-one (PubChem CID 86720058) has the molecular formula C30H23F6N7O3 and a molecular weight of 643.55 g/mol. Its IUPAC name is 9-[(2,4-dimethoxyphenyl)methyl]-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-(2,2,3,3,3-pentafluoropropyl)purin-8-one.
| Compound Name | 9-[(2,4-dimethoxyphenyl)methyl]-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-(2,2,3,3,3-pentafluoropropyl)purin-8-one |
|---|---|
| PubChem CID | 86720058 |
| Molecular Formula | C30H23F6N7O3 |
| Molecular Weight | 643.55 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | 9-[(2,4-dimethoxyphenyl)methyl]-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-(2,2,3,3,3-pentafluoropropyl)purin-8-one |
| SMILES | COc1ccc(Cn2c(=O)n(CC(F)(F)C(F)(F)F)c3cnc(-c4nn(Cc5ccccc5F)c5ncccc45)nc32)c(OC)c1 |
| InChI | InChI=1S/C30H23F6N7O3/c1-45-19-10-9-18(23(12-19)46-2)14-41-27-22(42(28(41)44)16-29(32,33)30(34,35)36)13-38-25(39-27)24-20-7-5-11-37-26(20)43(40-24)15-17-6-3-4-8-21(17)31/h3-13H,14-16H2,1-2H3 |
| InChIKey | XGCBWTPGYJFJRI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|