C23H19ClN2O4S2 — CID 86720595
N-[(7-chlorothieno[2,3-c]pyridin-2-yl)-phenylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 86720595) has the molecular formula C23H19ClN2O4S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is N-[(7-chlorothieno[2,3-c]pyridin-2-yl)-phenylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[(7-chlorothieno[2,3-c]pyridin-2-yl)-phenylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 86720595 |
| Molecular Formula | C23H19ClN2O4S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[(7-chlorothieno[2,3-c]pyridin-2-yl)-phenylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=S(=O)(NC(c1ccccc1)c1cc2ccnc(Cl)c2s1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H19ClN2O4S2/c24-23-22-16(9-10-25-23)13-20(31-22)21(15-5-2-1-3-6-15)26-32(27,28)17-7-8-18-19(14-17)30-12-4-11-29-18/h1-3,5-10,13-14,21,26H,4,11-12H2 |
| InChIKey | AKGGYOISENJYFS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|