C22H20Cl2N4O4 — CID 86720638
3,5-dichloro-4-[7-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-c]pyridine-3-carbonyl]-N-(2-methoxyethyl)benzamide (PubChem CID 86720638) has the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.33 g/mol. Its IUPAC name is 3,5-dichloro-4-[7-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-c]pyridine-3-carbonyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3,5-dichloro-4-[7-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-c]pyridine-3-carbonyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 86720638 |
| Molecular Formula | C22H20Cl2N4O4 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 3,5-dichloro-4-[7-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-c]pyridine-3-carbonyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(Cl)c(C(=O)c2c[nH]c3c(NC(=O)C4CC4)nccc23)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N4O4/c1-32-7-6-26-21(30)12-8-15(23)17(16(24)9-12)19(29)14-10-27-18-13(14)4-5-25-20(18)28-22(31)11-2-3-11/h4-5,8-11,27H,2-3,6-7H2,1H3,(H,26,30)(H,25,28,31) |
| InChIKey | WPWBBUDWDGEVKY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|