C8H10N2O — CID 86721908
7-Methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine (PubChem CID 86721908) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine.
| Compound Name | 7-Methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 86721908 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine |
| SMILES | CC1=NC=CC2=C1OCC2N |
| InChI | InChI=1S/C8H10N2O/c1-5-8-6(2-3-10-5)7(9)4-11-8/h2-3,7H,4,9H2,1H3 |
| InChIKey | HOWQVDSYSOSUIK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 151 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |