C27H29BrF2N4O5 — CID 86722061
tert-butyl N-[(2S)-1-[[3-bromo-2-[(3,5-difluorophenyl)carbamoyl]pyrrol-1-yl]amino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate (PubChem CID 86722061) has the molecular formula C27H29BrF2N4O5 and a molecular weight of 607.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[3-bromo-2-[(3,5-difluorophenyl)carbamoyl]pyrrol-1-yl]amino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[3-bromo-2-[(3,5-difluorophenyl)carbamoyl]pyrrol-1-yl]amino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86722061 |
| Molecular Formula | C27H29BrF2N4O5 |
| Molecular Weight | 607.45 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[3-bromo-2-[(3,5-difluorophenyl)carbamoyl]pyrrol-1-yl]amino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCOCc1ccccc1)C(=O)Nn1ccc(Br)c1C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H29BrF2N4O5/c1-27(2,3)39-26(37)32-22(10-12-38-16-17-7-5-4-6-8-17)24(35)33-34-11-9-21(28)23(34)25(36)31-20-14-18(29)13-19(30)15-20/h4-9,11,13-15,22H,10,12,16H2,1-3H3,(H,31,36)(H,32,37)(H,33,35)/t22-/m0/s1 |
| InChIKey | MTNUKGGOYBMBAW-QFIPXVFZSA-N |
| XLogP | 5.35 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|