C30H36F4N2O2Si — CID 86722374
(2R,5S,7S)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carbaldehyde (PubChem CID 86722374) has the molecular formula C30H36F4N2O2Si and a molecular weight of 560.71 g/mol. Its IUPAC name is (2R,5S,7S)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carbaldehyde.
| Compound Name | (2R,5S,7S)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carbaldehyde |
|---|---|
| PubChem CID | 86722374 |
| Molecular Formula | C30H36F4N2O2Si |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (2R,5S,7S)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C(F)(F)F)CC[C@]2(C=O)c3cc4cnn(-c5ccc(F)cc5)c4cc3CCC[C@H]2C1 |
| InChI | InChI=1S/C30H36F4N2O2Si/c1-4-39(5-2,6-3)38-29(30(32,33)34)15-14-28(20-37)23(18-29)9-7-8-21-17-27-22(16-26(21)28)19-35-36(27)25-12-10-24(31)11-13-25/h10-13,16-17,19-20,23H,4-9,14-15,18H2,1-3H3/t23-,28+,29-/m0/s1 |
| InChIKey | MTJLLELHCNSZTA-QKZGOTKPSA-N |
| XLogP | 8.06 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|