C32H41F4N3O2Si — CID 86722382
N-[[(2S,5R,7R)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-2-yl]methyl]acetamide (PubChem CID 86722382) has the molecular formula C32H41F4N3O2Si and a molecular weight of 603.78 g/mol. Its IUPAC name is N-[[(2S,5R,7R)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-2-yl]methyl]acetamide.
| Compound Name | N-[[(2S,5R,7R)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 86722382 |
| Molecular Formula | C32H41F4N3O2Si |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | N-[[(2S,5R,7R)-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-2-yl]methyl]acetamide |
| SMILES | CC[Si](CC)(CC)O[C@]1(C(F)(F)F)CC[C@@]2(CNC(C)=O)c3cc4cnn(-c5ccc(F)cc5)c4cc3CCC[C@@H]2C1 |
| InChI | InChI=1S/C32H41F4N3O2Si/c1-5-42(6-2,7-3)41-31(32(34,35)36)16-15-30(21-37-22(4)40)25(19-31)10-8-9-23-18-29-24(17-28(23)30)20-38-39(29)27-13-11-26(33)12-14-27/h11-14,17-18,20,25H,5-10,15-16,19,21H2,1-4H3,(H,37,40)/t25-,30+,31-/m1/s1 |
| InChIKey | UCDVZFQJKRMPFX-SDDUWZMOSA-N |
| XLogP | 8.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|