C30H36F4N2O3Si — CID 86722383
14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxylic acid (PubChem CID 86722383) has the molecular formula C30H36F4N2O3Si and a molecular weight of 576.71 g/mol. Its IUPAC name is 14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxylic acid.
| Compound Name | 14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxylic acid |
|---|---|
| PubChem CID | 86722383 |
| Molecular Formula | C30H36F4N2O3Si |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxylic acid |
| SMILES | CC[Si](CC)(CC)OC1(C(F)(F)F)CCC2(C(=O)O)c3cc4cnn(-c5ccc(F)cc5)c4cc3CCCC2C1 |
| InChI | InChI=1S/C30H36F4N2O3Si/c1-4-40(5-2,6-3)39-28(30(32,33)34)14-15-29(27(37)38)22(18-28)9-7-8-20-17-26-21(16-25(20)29)19-35-36(26)24-12-10-23(31)11-13-24/h10-13,16-17,19,22H,4-9,14-15,18H2,1-3H3,(H,37,38) |
| InChIKey | OXSBMUHRWGXEHK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|