C33H41F4N3O2Si — CID 86722385
N-cyclopropyl-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxamide (PubChem CID 86722385) has the molecular formula C33H41F4N3O2Si and a molecular weight of 615.79 g/mol. Its IUPAC name is N-cyclopropyl-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxamide.
| Compound Name | N-cyclopropyl-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 86722385 |
| Molecular Formula | C33H41F4N3O2Si |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-cyclopropyl-14-(4-fluorophenyl)-5-triethylsilyloxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-2-carboxamide |
| SMILES | CC[Si](CC)(CC)OC1(C(F)(F)F)CCC2(C(=O)NC3CC3)c3cc4cnn(-c5ccc(F)cc5)c4cc3CCCC2C1 |
| InChI | InChI=1S/C33H41F4N3O2Si/c1-4-43(5-2,6-3)42-31(33(35,36)37)16-17-32(30(41)39-26-12-13-26)24(20-31)9-7-8-22-19-29-23(18-28(22)32)21-38-40(29)27-14-10-25(34)11-15-27/h10-11,14-15,18-19,21,24,26H,4-9,12-13,16-17,20H2,1-3H3,(H,39,41) |
| InChIKey | ARJXTUAVIYYQAD-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|