C13H16N2O — CID 867224
1-[2-(2,5-dimethylphenoxy)ethyl]imidazole (PubChem CID 867224) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenoxy)ethyl]imidazole.
| Compound Name | 1-[2-(2,5-dimethylphenoxy)ethyl]imidazole |
|---|---|
| PubChem CID | 867224 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[2-(2,5-dimethylphenoxy)ethyl]imidazole |
| SMILES | Cc1ccc(C)c(OCCn2ccnc2)c1 |
| InChI | InChI=1S/C13H16N2O/c1-11-3-4-12(2)13(9-11)16-8-7-15-6-5-14-10-15/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | KNUNBYRXGBIQHS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |