C19H27NO3 — CID 86722437
11'a-ethyl-2'-methylspiro[1,3-dioxolane-2,9'-6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine]-3'-amine (PubChem CID 86722437) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 11'a-ethyl-2'-methylspiro[1,3-dioxolane-2,9'-6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine]-3'-amine.
| Compound Name | 11'a-ethyl-2'-methylspiro[1,3-dioxolane-2,9'-6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine]-3'-amine |
|---|---|
| PubChem CID | 86722437 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 11'a-ethyl-2'-methylspiro[1,3-dioxolane-2,9'-6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine]-3'-amine |
| SMILES | CCC12CCC3(CC1CCOc1cc(N)c(C)cc12)OCCO3 |
| InChI | InChI=1S/C19H27NO3/c1-3-18-5-6-19(22-8-9-23-19)12-14(18)4-7-21-17-11-16(20)13(2)10-15(17)18/h10-11,14H,3-9,12,20H2,1-2H3 |
| InChIKey | FBPKMVCUADFXGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|