C23H25F3N2O5S — CID 86722479
[1'-(pyridin-2-ylmethyl)spiro[1,3-dioxolane-2,13'-4-azatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene]-5'-yl] trifluoromethanesulfonate (PubChem CID 86722479) has the molecular formula C23H25F3N2O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is [1'-(pyridin-2-ylmethyl)spiro[1,3-dioxolane-2,13'-4-azatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene]-5'-yl] trifluoromethanesulfonate.
| Compound Name | [1'-(pyridin-2-ylmethyl)spiro[1,3-dioxolane-2,13'-4-azatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene]-5'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86722479 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [1'-(pyridin-2-ylmethyl)spiro[1,3-dioxolane-2,13'-4-azatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene]-5'-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cn1)C1(Cc3ccccn3)CCC3(CC1CCC2)OCCO3)C(F)(F)F |
| InChI | InChI=1S/C23H25F3N2O5S/c24-23(25,26)34(29,30)33-20-12-16-4-3-5-17-13-22(31-10-11-32-22)8-7-21(17,19(16)15-28-20)14-18-6-1-2-9-27-18/h1-2,6,9,12,15,17H,3-5,7-8,10-11,13-14H2 |
| InChIKey | STKFWGVEULYPNF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|