C21H17BrCl3F3N2O2 — CID 86722548
2-bromo-N'-methyl-N'-propanoyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide (PubChem CID 86722548) has the molecular formula C21H17BrCl3F3N2O2 and a molecular weight of 572.64 g/mol. Its IUPAC name is 2-bromo-N'-methyl-N'-propanoyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide.
| Compound Name | 2-bromo-N'-methyl-N'-propanoyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 86722548 |
| Molecular Formula | C21H17BrCl3F3N2O2 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 569.95 |
| IUPAC Name | 2-bromo-N'-methyl-N'-propanoyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
| SMILES | CCC(=O)N(C)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C21H17BrCl3F3N2O2/c1-3-18(31)30(2)29-20(32)13-6-4-11(8-15(13)22)5-7-14(21(26,27)28)12-9-16(23)19(25)17(24)10-12/h4-10,14H,3H2,1-2H3,(H,29,32)/b7-5+ |
| InChIKey | PDWLIMBONUYMTK-FNORWQNLSA-N |
| XLogP | 7.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|