C24H19Cl3F9N3O2 — CID 86722579
1-propan-2-yl-3-(2,2,2-trifluoroethyl)-1-[[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea (PubChem CID 86722579) has the molecular formula C24H19Cl3F9N3O2 and a molecular weight of 658.78 g/mol. Its IUPAC name is 1-propan-2-yl-3-(2,2,2-trifluoroethyl)-1-[[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea.
| Compound Name | 1-propan-2-yl-3-(2,2,2-trifluoroethyl)-1-[[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 86722579 |
| Molecular Formula | C24H19Cl3F9N3O2 |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 657.04 |
| IUPAC Name | 1-propan-2-yl-3-(2,2,2-trifluoroethyl)-1-[[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
| SMILES | CC(C)N(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H19Cl3F9N3O2/c1-11(2)39(21(41)37-10-22(28,29)30)38-20(40)14-5-3-12(7-16(14)24(34,35)36)4-6-15(23(31,32)33)13-8-17(25)19(27)18(26)9-13/h3-9,11,15H,10H2,1-2H3,(H,37,41)(H,38,40)/b6-4+ |
| InChIKey | UDPIJIXTYKGXRR-GQCTYLIASA-N |
| XLogP | 8.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|