C23H21BrCl3F3N2O3 — CID 86722589
tert-butyl N-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-N-methylcarbamate (PubChem CID 86722589) has the molecular formula C23H21BrCl3F3N2O3 and a molecular weight of 616.69 g/mol. Its IUPAC name is tert-butyl N-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 86722589 |
| Molecular Formula | C23H21BrCl3F3N2O3 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 613.98 |
| IUPAC Name | tert-butyl N-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-N-methylcarbamate |
| SMILES | CN(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H21BrCl3F3N2O3/c1-22(2,3)35-21(34)32(4)31-20(33)14-7-5-12(9-16(14)24)6-8-15(23(28,29)30)13-10-17(25)19(27)18(26)11-13/h5-11,15H,1-4H3,(H,31,33)/b8-6+ |
| InChIKey | DIXAPJVCGYWFBK-SOFGYWHQSA-N |
| XLogP | 8.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|