About 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine
6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine (PubChem CID 86722861) has the molecular formula C19H19FIN3O3
and a molecular weight of 483.28 g/mol. Its IUPAC name is 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine |
| PubChem CID | 86722861 |
| Molecular Formula | C19H19FIN3O3 |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine |
| SMILES | COc1cc(OC)c(F)c(-c2cc3c(cn2)c(I)nn3C2CCCCO2)c1 |
| InChI | InChI=1S/C19H19FIN3O3/c1-25-11-7-12(18(20)16(8-11)26-2)14-9-15-13(10-22-14)19(21)23-24(15)17-5-3-4-6-27-17/h7-10,17H,3-6H2,1-2H3 |
| InChIKey | WCYICTGEKSIBQT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine?
The IUPAC name of 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine (CID 86722861) is 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine?
The canonical SMILES for 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine is COc1cc(OC)c(F)c(-c2cc3c(cn2)c(I)nn3C2CCCCO2)c1.
What is the InChIKey of 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine?
The InChIKey is WCYICTGEKSIBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FIN3O3/c1-25-11-7-12(18(20)16(8-11)26-2)14-9-15-13(10-22-14)19(21)23-24(15)17-5-3-4-6-27-17/h7-10,17H,3-6H2,1-2H3.
What are the key properties of 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine?
6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine has a molecular weight of 483.28 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluoro-3,5-dimethoxyphenyl)-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 86722861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).