C14H28N2O2Si — CID 86723179
(8R,9aS)-8-triethylsilyloxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one (PubChem CID 86723179) has the molecular formula C14H28N2O2Si and a molecular weight of 284.48 g/mol. Its IUPAC name is (8R,9aS)-8-triethylsilyloxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one.
| Compound Name | (8R,9aS)-8-triethylsilyloxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 86723179 |
| Molecular Formula | C14H28N2O2Si |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (8R,9aS)-8-triethylsilyloxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H]2C(=O)NCCCN2C1 |
| InChI | InChI=1S/C14H28N2O2Si/c1-4-19(5-2,6-3)18-12-10-13-14(17)15-8-7-9-16(13)11-12/h12-13H,4-11H2,1-3H3,(H,15,17)/t12-,13+/m1/s1 |
| InChIKey | WIALHOKJMLKORS-OLZOCXBDSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|