About 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide
4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide (PubChem CID 86723207) has the molecular formula C19H16FN5O2S
and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide |
| PubChem CID | 86723207 |
| Molecular Formula | C19H16FN5O2S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide |
| SMILES | CCn1cnc2c(-c3ccc(F)c(-c4ccc(S(N)(=O)=O)cc4)c3)cnnc21 |
| InChI | InChI=1S/C19H16FN5O2S/c1-2-25-11-22-18-16(10-23-24-19(18)25)13-5-8-17(20)15(9-13)12-3-6-14(7-4-12)28(21,26)27/h3-11H,2H2,1H3,(H2,21,26,27) |
| InChIKey | HJWSOSQLQQNWPN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide?
The IUPAC name of 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide (CID 86723207) is 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide.
What is the SMILES notation for 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide?
The canonical SMILES for 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide is CCn1cnc2c(-c3ccc(F)c(-c4ccc(S(N)(=O)=O)cc4)c3)cnnc21.
What is the InChIKey of 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide?
The InChIKey is HJWSOSQLQQNWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN5O2S/c1-2-25-11-22-18-16(10-23-24-19(18)25)13-5-8-17(20)15(9-13)12-3-6-14(7-4-12)28(21,26)27/h3-11H,2H2,1H3,(H2,21,26,27).
What are the key properties of 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide?
4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide has a molecular weight of 397.44 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]benzenesulfonamide is sourced from PubChem (CID 86723207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).