About 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine
4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine (PubChem CID 86723232) has the molecular formula C13H10BrFN4
and a molecular weight of 321.15 g/mol. Its IUPAC name is 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine.
Molecular Properties
| Compound Name | 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine |
| PubChem CID | 86723232 |
| Molecular Formula | C13H10BrFN4 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine |
| SMILES | CCn1cnc2c(-c3ccc(F)c(Br)c3)cnnc21 |
| InChI | InChI=1S/C13H10BrFN4/c1-2-19-7-16-12-9(6-17-18-13(12)19)8-3-4-11(15)10(14)5-8/h3-7H,2H2,1H3 |
| InChIKey | RMCQDIUMPYNITR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine?
The IUPAC name of 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine (CID 86723232) is 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine.
What is the SMILES notation for 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine?
The canonical SMILES for 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine is CCn1cnc2c(-c3ccc(F)c(Br)c3)cnnc21.
What is the InChIKey of 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine?
The InChIKey is RMCQDIUMPYNITR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrFN4/c1-2-19-7-16-12-9(6-17-18-13(12)19)8-3-4-11(15)10(14)5-8/h3-7H,2H2,1H3.
What are the key properties of 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine?
4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine has a molecular weight of 321.15 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-4-fluorophenyl)-7-ethylimidazo[4,5-c]pyridazine is sourced from PubChem (CID 86723232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).