About 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile
3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile (PubChem CID 86723314) has the molecular formula C13H4Cl2FN3S
and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile |
| PubChem CID | 86723314 |
| Molecular Formula | C13H4Cl2FN3S |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(-c2nc3ccnc(Cl)c3s2)c(Cl)c1 |
| InChI | InChI=1S/C13H4Cl2FN3S/c14-7-3-6(5-17)4-8(16)10(7)13-19-9-1-2-18-12(15)11(9)20-13/h1-4H |
| InChIKey | PKIIUGYQBOBPAD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile?
The IUPAC name of 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile (CID 86723314) is 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile.
What is the SMILES notation for 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile?
The canonical SMILES for 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile is N#Cc1cc(F)c(-c2nc3ccnc(Cl)c3s2)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile?
The InChIKey is PKIIUGYQBOBPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H4Cl2FN3S/c14-7-3-6(5-17)4-8(16)10(7)13-19-9-1-2-18-12(15)11(9)20-13/h1-4H.
What are the key properties of 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile?
3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile has a molecular weight of 324.17 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(4-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-fluorobenzonitrile is sourced from PubChem (CID 86723314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).