C23H33ClN6O3 — CID 86723926
tert-butyl (2R,5R)-5-(azidomethyl)-4-[2-(6-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylate (PubChem CID 86723926) has the molecular formula C23H33ClN6O3 and a molecular weight of 477.01 g/mol. Its IUPAC name is tert-butyl (2R,5R)-5-(azidomethyl)-4-[2-(6-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-5-(azidomethyl)-4-[2-(6-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86723926 |
| Molecular Formula | C23H33ClN6O3 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | tert-butyl (2R,5R)-5-(azidomethyl)-4-[2-(6-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(CC(=O)N2CC(C)(C)c3ccc(Cl)cc32)[C@@H](CN=[N+]=[N-])CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33ClN6O3/c1-15-11-28(17(10-26-27-25)12-29(15)21(32)33-22(2,3)4)13-20(31)30-14-23(5,6)18-8-7-16(24)9-19(18)30/h7-9,15,17H,10-14H2,1-6H3/t15-,17+/m1/s1 |
| InChIKey | CFTZVKGEUICTAU-WBVHZDCISA-N |
| XLogP | 4.58 |
| TPSA | 101.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|