C10H14N2O — CID 86723979
3,3,6-trimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one (PubChem CID 86723979) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 3,3,6-trimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one.
| Compound Name | 3,3,6-trimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one |
|---|---|
| PubChem CID | 86723979 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3,3,6-trimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one |
| SMILES | Cn1cc2c(cc1=O)C(C)(C)CN2 |
| InChI | InChI=1S/C10H14N2O/c1-10(2)6-11-8-5-12(3)9(13)4-7(8)10/h4-5,11H,6H2,1-3H3 |
| InChIKey | NNLYYVNNXLRHFD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|