About [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate
[2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 8672444) has the molecular formula C18H19FN2O3
and a molecular weight of 330.36 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate |
| PubChem CID | 8672444 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc(F)cc2)c(C)n1C1CC1 |
| InChI | InChI=1S/C18H19FN2O3/c1-11-9-16(12(2)21(11)15-7-8-15)18(23)24-10-17(22)20-14-5-3-13(19)4-6-14/h3-6,9,15H,7-8,10H2,1-2H3,(H,20,22) |
| InChIKey | PJQNBCKBWUNEJQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate?
The IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate (CID 8672444) is [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate.
What is the SMILES notation for [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate?
The canonical SMILES for [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate is Cc1cc(C(=O)OCC(=O)Nc2ccc(F)cc2)c(C)n1C1CC1.
What is the InChIKey of [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate?
The InChIKey is PJQNBCKBWUNEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O3/c1-11-9-16(12(2)21(11)15-7-8-15)18(23)24-10-17(22)20-14-5-3-13(19)4-6-14/h3-6,9,15H,7-8,10H2,1-2H3,(H,20,22).
What are the key properties of [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate?
[2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate has a molecular weight of 330.36 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoroanilino)-2-oxoethyl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate is sourced from PubChem (CID 8672444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).