About 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine
2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine (PubChem CID 86724469) has the molecular formula C13H19Cl2N3
and a molecular weight of 288.22 g/mol. Its IUPAC name is 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine.
Molecular Properties
| Compound Name | 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine |
| PubChem CID | 86724469 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine |
| SMILES | CC1CCC(CNc2c(N)cc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C13H19Cl2N3/c1-8-2-4-9(5-3-8)7-17-12-10(16)6-11(14)18-13(12)15/h6,8-9,17H,2-5,7H2,1H3,(H2,16,18) |
| InChIKey | DNFPIDCRQXAIOY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine?
The IUPAC name of 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine (CID 86724469) is 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine.
What is the SMILES notation for 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine?
The canonical SMILES for 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine is CC1CCC(CNc2c(N)cc(Cl)nc2Cl)CC1.
What is the InChIKey of 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine?
The InChIKey is DNFPIDCRQXAIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2N3/c1-8-2-4-9(5-3-8)7-17-12-10(16)6-11(14)18-13(12)15/h6,8-9,17H,2-5,7H2,1H3,(H2,16,18).
What are the key properties of 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine?
2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine has a molecular weight of 288.22 g/mol, XLogP of 4.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-N-[(4-methylcyclohexyl)methyl]pyridine-3,4-diamine is sourced from PubChem (CID 86724469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).